1,9-Dioxa-2,8,10,16-tetrasilacyclohexadecane-5,13-dione,2,2,8,8,10,10,16,16-octamethyl- structure
|
Common Name | 1,9-Dioxa-2,8,10,16-tetrasilacyclohexadecane-5,13-dione,2,2,8,8,10,10,16,16-octamethyl- | ||
|---|---|---|---|---|
| CAS Number | 18623-13-7 | Molecular Weight | 432.85000 | |
| Density | 0.95g/cm3 | Boiling Point | 419.9ºC at 760mmHg | |
| Molecular Formula | C18H40O4Si4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.6ºC | |
| Name | 2,2,8,8,10,10,16,16-octamethyl-1,9-dioxa-2,8,10,16-tetrasilacyclohexadecane-5,13-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 0.95g/cm3 |
|---|---|
| Boiling Point | 419.9ºC at 760mmHg |
| Molecular Formula | C18H40O4Si4 |
| Molecular Weight | 432.85000 |
| Flash Point | 172.6ºC |
| Exact Mass | 432.20000 |
| PSA | 52.60000 |
| LogP | 5.55220 |
| Vapour Pressure | 2.92E-07mmHg at 25°C |
| Index of Refraction | 1.45 |
| InChIKey | SMTBPEGDHXMICH-UHFFFAOYSA-N |
| SMILES | C[Si]1(C)CCC(=O)CC[Si](C)(C)O[Si](C)(C)CCC(=O)CC[Si](C)(C)O1 |
|
~%
1,9-Dioxa-2,8,1... CAS#:18623-13-7 |
| Literature: Gmelin Handbook: Si: MVol.C, 108, page 298 - 303 |
|
~%
1,9-Dioxa-2,8,1... CAS#:18623-13-7 |
| Literature: Sommer et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 2932 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,2,8,8,10,10,16,16-octamethyl-1,9-dioxa-2,8,10,16-tetrasila-cyclohexadecane-5,13-dione |
| 2,2,8,8,10,10,16,16-Octamethyl-1,9-dioxa-2,8,10,16-tetrasila-cyclohexadecan-5,13-dion |