(4-TRIFLUOROMETHYLPHENYL)PHOSPHINE structure
|
Common Name | (4-TRIFLUOROMETHYLPHENYL)PHOSPHINE | ||
|---|---|---|---|---|
| CAS Number | 18630-93-8 | Molecular Weight | 217.22100 | |
| Density | 1.313g/cm3 | Boiling Point | 432.7ºC at 760mmHg | |
| Molecular Formula | C12H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.5ºC | |
| Name | (4Z)-4-(Ethoxymethylene)-1,3(2H,4H)-isoquinolinedione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.313g/cm3 |
|---|---|
| Boiling Point | 432.7ºC at 760mmHg |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22100 |
| Flash Point | 215.5ºC |
| Exact Mass | 217.07400 |
| PSA | 58.89000 |
| LogP | 1.34440 |
| Vapour Pressure | 1.09E-07mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | UPFHOYKZRKIAIQ-JXMROGBWSA-N |
| SMILES | CCOC=C1C(=O)NC(=O)c2ccccc21 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzoic acid,4-(ethoxymethyl) |
| 4-Aethoxymethyl-benzoesaeure |
| 4-Ethoxymethyl-benzoic acid |
| 4-Ethoxymethylen-1,3-dioxo-1,2,3,4-tetrahydroisochinolin |
| 4-ethoxymethylene-4H-isoquinoline-1,3-dione |