5-Bromo-2-chloro-N,N-dimethylisonicotinamide
Modify Date: 2025-09-06 07:18:20
5-Bromo-2-chloro-N,N-dimethylisonicotinamide structure
|
Common Name | 5-Bromo-2-chloro-N,N-dimethylisonicotinamide | ||
|---|---|---|---|---|
| CAS Number | 1863453-75-1 | Molecular Weight | 263.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8BrClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Bromo-2-chloro-N,N-dimethylisonicotinamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H8BrClN2O |
|---|---|
| Molecular Weight | 263.52 |
| InChIKey | XUTXKDNPJRIKRT-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)c1cc(Cl)ncc1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1863453-75-1? |
| A: Chinese name of 1863453-75-1 is 1863453-75-1. |
| Q: What is the molecular weight of 5-Bromo-2-chloro-N,N-dimethylisonicotinamide? |
| A: Molecular weight of 5-Bromo-2-chloro-N,N-dimethylisonicotinamide is 263.52. |
| Q: What is the SMILES notation of 5-Bromo-2-chloro-N,N-dimethylisonicotinamide? |
| A: SMILES notation of 5-Bromo-2-chloro-N,N-dimethylisonicotinamide is CN(C)C(=O)c1cc(Cl)ncc1Br. |
| Q: What is the InChIKey of 5-Bromo-2-chloro-N,N-dimethylisonicotinamide? |
| A: InChIKey of 5-Bromo-2-chloro-N,N-dimethylisonicotinamide is XUTXKDNPJRIKRT-UHFFFAOYSA-N. |
| Q: What is the English name of 5-Bromo-2-chloro-N,N-dimethylisonicotinamide? |
| A: The English name of 5-Bromo-2-chloro-N,N-dimethylisonicotinamide is 5-Bromo-2-chloro-N,N-dimethylisonicotinamide. |
| Q: What is the molecular formula of 5-Bromo-2-chloro-N,N-dimethylisonicotinamide? |
| A: Molecular formula of 5-Bromo-2-chloro-N,N-dimethylisonicotinamide is C8H8BrClN2O. |
| Q: What is the CAS number of 5-Bromo-2-chloro-N,N-dimethylisonicotinamide? |
| A: CAS number of 5-Bromo-2-chloro-N,N-dimethylisonicotinamide is 1863453-75-1. |