(4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one
(4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one structure
|
Common Name | (4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 186355-83-9 | Molecular Weight | 264.11600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one, CAS number 186355-83-9, molecular formula C9H14BrNO3, molecular weight 264.11600, For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H14BrNO3 |
|---|---|
| Molecular Weight | 264.11600 |
| Exact Mass | 263.01600 |
| PSA | 46.61000 |
| LogP | 1.71110 |
| InChIKey | MNJZLTZJKSZFJF-COBSHVIPSA-N |
| SMILES | CC(Br)C(=O)N1C(=O)OCC1C(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~56%
(4S)-3-(2-bromo... CAS#:186355-83-9 |
| Literature: Candeias; Jenkins; Ribeiro; Afonso; Caddick Synthetic Communications, 2001 , vol. 31, # 21 p. 3241 - 3254 |
|
~%
(4S)-3-(2-bromo... CAS#:186355-83-9 |
| Literature: Sumitomo Pharmaceuticals Company, Limited Patent: US5231179 A1, 1993 ; |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one? |
| A: SMILES notation of (4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one is CC(Br)C(=O)N1C(=O)OCC1C(C)C. |
| Q: What is the molecular weight of (4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one? |
| A: Molecular weight of (4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one is 264.11600. |
| Q: What is the Chinese name of 186355-83-9? |
| A: Chinese name of 186355-83-9 is 186355-83-9. |
| Q: What is the LogP of (4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one? |
| A: LogP of (4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one is 1.71110. |
| Q: What is the molecular formula of (4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one? |
| A: Molecular formula of (4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one is C9H14BrNO3. |
| Q: What is the English name of (4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one? |
| A: The English name of (4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one is (4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one. |
| Q: What is the InChIKey of (4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one? |
| A: InChIKey of (4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one is MNJZLTZJKSZFJF-COBSHVIPSA-N. |
| Q: What is the CAS number of (4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one? |
| A: CAS number of (4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one is 186355-83-9. |
| Q: What is the polar surface area (PSA) of (4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one? |
| A: Polar surface area (PSA) of (4S)-3-(2-bromopropanoyl)-4-propan-2-yl-1,3-oxazolidin-2-one is 46.61000. |