Benzo[a]phenazine 7-oxide structure
|
Common Name | Benzo[a]phenazine 7-oxide | ||
|---|---|---|---|---|
| CAS Number | 18636-86-7 | Molecular Weight | 246.26300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-oxidobenzo[a]phenazin-7-ium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H10N2O |
|---|---|
| Molecular Weight | 246.26300 |
| Exact Mass | 246.07900 |
| PSA | 38.35000 |
| LogP | 3.96970 |
| InChIKey | AXRCMVJRLLPGTB-UHFFFAOYSA-N |
| SMILES | [O-][n+]1c2ccccc2nc2c3ccccc3ccc21 |
| HS Code | 2933990090 |
|---|
|
~%
Benzo[a]phenazi... CAS#:18636-86-7 |
| Literature: Maffei Gazzetta Chimica Italiana, 1946 , vol. 76, p. 239,243 |
|
~%
Benzo[a]phenazi... CAS#:18636-86-7 |
| Literature: Pachter; Kloetzel Journal of the American Chemical Society, 1951 , vol. 73, p. 4958,4960 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzo<a>phenazin-N-oxyd |
| Benzo<a>phenazin-7-oxid |