ethyl N-bis[(4-methylphenyl)amino]phosphorylcarbamate structure
|
Common Name | ethyl N-bis[(4-methylphenyl)amino]phosphorylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 18639-03-7 | Molecular Weight | 347.34900 | |
| Density | 1.264g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H22N3O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-bis(4-methylanilino)phosphorylcarbamate |
|---|
| Density | 1.264g/cm3 |
|---|---|
| Molecular Formula | C17H22N3O3P |
| Molecular Weight | 347.34900 |
| Exact Mass | 347.14000 |
| PSA | 89.27000 |
| LogP | 5.21850 |
| Index of Refraction | 1.617 |
| InChIKey | NBWGSOFDDGNTBI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NP(=O)(Nc1ccc(C)cc1)Nc1ccc(C)cc1 |
|
~%
ethyl N-bis[(4-... CAS#:18639-03-7 |
| Literature: Cates; Nelson Journal of pharmaceutical sciences, 1968 , vol. 57, # 1 p. 189 - 190 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |