3-[(2S,4R)-4-methoxypyrrolidin-2-yl]-4H-1,2,4-triazole hydrochloride structure
|
Common Name | 3-[(2S,4R)-4-methoxypyrrolidin-2-yl]-4H-1,2,4-triazole hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1864003-30-4 | Molecular Weight | 204.66 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H13ClN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[(2S,4R)-4-methoxypyrrolidin-2-yl]-4H-1,2,4-triazole hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H13ClN4O |
|---|---|
| Molecular Weight | 204.66 |
| InChIKey | QDQDBJHFAVCMDA-IBTYICNHSA-N |
| SMILES | COC1CNC(c2ncn[nH]2)C1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-[(2S,4R)-4-methoxypyrrolidin-2-yl]-4H-1,2,4-triazole hydrochloride? |
| A: The English name of 3-[(2S,4R)-4-methoxypyrrolidin-2-yl]-4H-1,2,4-triazole hydrochloride is 3-[(2S,4R)-4-methoxypyrrolidin-2-yl]-4H-1,2,4-triazole hydrochloride. |
| Q: What is the molecular formula of 3-[(2S,4R)-4-methoxypyrrolidin-2-yl]-4H-1,2,4-triazole hydrochloride? |
| A: Molecular formula of 3-[(2S,4R)-4-methoxypyrrolidin-2-yl]-4H-1,2,4-triazole hydrochloride is C7H13ClN4O. |
| Q: What is the InChIKey of 3-[(2S,4R)-4-methoxypyrrolidin-2-yl]-4H-1,2,4-triazole hydrochloride? |
| A: InChIKey of 3-[(2S,4R)-4-methoxypyrrolidin-2-yl]-4H-1,2,4-triazole hydrochloride is QDQDBJHFAVCMDA-IBTYICNHSA-N. |
| Q: What is the molecular weight of 3-[(2S,4R)-4-methoxypyrrolidin-2-yl]-4H-1,2,4-triazole hydrochloride? |
| A: Molecular weight of 3-[(2S,4R)-4-methoxypyrrolidin-2-yl]-4H-1,2,4-triazole hydrochloride is 204.66. |
| Q: What is the Chinese name of 1864003-30-4? |
| A: Chinese name of 1864003-30-4 is 1864003-30-4. |
| Q: What is the SMILES notation of 3-[(2S,4R)-4-methoxypyrrolidin-2-yl]-4H-1,2,4-triazole hydrochloride? |
| A: SMILES notation of 3-[(2S,4R)-4-methoxypyrrolidin-2-yl]-4H-1,2,4-triazole hydrochloride is COC1CNC(c2ncn[nH]2)C1.Cl. |
| Q: What is the CAS number of 3-[(2S,4R)-4-methoxypyrrolidin-2-yl]-4H-1,2,4-triazole hydrochloride? |
| A: CAS number of 3-[(2S,4R)-4-methoxypyrrolidin-2-yl]-4H-1,2,4-triazole hydrochloride is 1864003-30-4. |