potassium 4-ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-sulfonate
Modify Date: 2026-08-25 13:01:40
potassium 4-ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-sulfonate structure
|
Common Name | potassium 4-ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-sulfonate | ||
|---|---|---|---|---|
| CAS Number | 1864054-14-7 | Molecular Weight | 319.42 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14KN3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | potassium 4-ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-sulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14KN3O3S |
|---|---|
| Molecular Weight | 319.42 |
| InChIKey | MWJWUKSWYZXWLL-UHFFFAOYSA-M |
| SMILES | CCn1c(CCc2ccccc2)nnc1S(=O)(=O)[O-].[K+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of potassium 4-ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-sulfonate? |
| A: InChIKey of potassium 4-ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-sulfonate is MWJWUKSWYZXWLL-UHFFFAOYSA-M. |
| Q: What is the Chinese name of 1864054-14-7? |
| A: Chinese name of 1864054-14-7 is 1864054-14-7. |
| Q: What is the molecular weight of potassium 4-ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-sulfonate? |
| A: Molecular weight of potassium 4-ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-sulfonate is 319.42. |
| Q: What is the CAS number of potassium 4-ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-sulfonate? |
| A: CAS number of potassium 4-ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-sulfonate is 1864054-14-7. |
| Q: What is the English name of potassium 4-ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-sulfonate? |
| A: The English name of potassium 4-ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-sulfonate is potassium 4-ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-sulfonate. |
| Q: What is the SMILES notation of potassium 4-ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-sulfonate? |
| A: SMILES notation of potassium 4-ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-sulfonate is CCn1c(CCc2ccccc2)nnc1S(=O)(=O)[O-].[K+]. |
| Q: What is the molecular formula of potassium 4-ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-sulfonate? |
| A: Molecular formula of potassium 4-ethyl-5-(2-phenylethyl)-4H-1,2,4-triazole-3-sulfonate is C12H14KN3O3S. |