2-[(4-fluorophenyl)methyl]-1H-1,3-benzodiazol-5-amine dihydrochloride
Modify Date: 2026-07-04 21:23:01
![2-[(4-fluorophenyl)methyl]-1H-1,3-benzodiazol-5-amine dihydrochloride Structure](https://www.chemsrc.com/extcaspic/388/1864061-46-0.png)
2-[(4-fluorophenyl)methyl]-1H-1,3-benzodiazol-5-amine dihydrochloride structure
|
Common Name | 2-[(4-fluorophenyl)methyl]-1H-1,3-benzodiazol-5-amine dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1864061-46-0 | Molecular Weight | 314.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14Cl2FN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(4-fluorophenyl)methyl]-1H-1,3-benzodiazol-5-amine dihydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H14Cl2FN3 |
|---|---|
| Molecular Weight | 314.2 |
| InChIKey | CXKHMOOVJHKCJZ-UHFFFAOYSA-N |
| SMILES | Cl.Cl.Nc1ccc2nc(Cc3ccc(F)cc3)[nH]c2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-[(4-fluorophenyl)methyl]-1H-1,3-benzodiazol-5-amine dihydrochloride? |
| A: CAS number of 2-[(4-fluorophenyl)methyl]-1H-1,3-benzodiazol-5-amine dihydrochloride is 1864061-46-0. |
| Q: What is the InChIKey of 2-[(4-fluorophenyl)methyl]-1H-1,3-benzodiazol-5-amine dihydrochloride? |
| A: InChIKey of 2-[(4-fluorophenyl)methyl]-1H-1,3-benzodiazol-5-amine dihydrochloride is CXKHMOOVJHKCJZ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1864061-46-0? |
| A: Chinese name of 1864061-46-0 is 1864061-46-0. |
| Q: What is the molecular weight of 2-[(4-fluorophenyl)methyl]-1H-1,3-benzodiazol-5-amine dihydrochloride? |
| A: Molecular weight of 2-[(4-fluorophenyl)methyl]-1H-1,3-benzodiazol-5-amine dihydrochloride is 314.2. |
| Q: What is the English name of 2-[(4-fluorophenyl)methyl]-1H-1,3-benzodiazol-5-amine dihydrochloride? |
| A: The English name of 2-[(4-fluorophenyl)methyl]-1H-1,3-benzodiazol-5-amine dihydrochloride is 2-[(4-fluorophenyl)methyl]-1H-1,3-benzodiazol-5-amine dihydrochloride. |
| Q: What is the molecular formula of 2-[(4-fluorophenyl)methyl]-1H-1,3-benzodiazol-5-amine dihydrochloride? |
| A: Molecular formula of 2-[(4-fluorophenyl)methyl]-1H-1,3-benzodiazol-5-amine dihydrochloride is C14H14Cl2FN3. |
| Q: What is the SMILES notation of 2-[(4-fluorophenyl)methyl]-1H-1,3-benzodiazol-5-amine dihydrochloride? |
| A: SMILES notation of 2-[(4-fluorophenyl)methyl]-1H-1,3-benzodiazol-5-amine dihydrochloride is Cl.Cl.Nc1ccc2nc(Cc3ccc(F)cc3)[nH]c2c1. |