4-methyl-2-{[1-(propan-2-yl)-1H-pyrazol-3-yl]methyl}pentanoic acid hydrochloride
Modify Date: 2025-08-21 14:11:24
![4-methyl-2-{[1-(propan-2-yl)-1H-pyrazol-3-yl]methyl}pentanoic acid hydrochloride Structure](https://www.chemsrc.com/extcaspic/494/1864062-03-2.png)
4-methyl-2-{[1-(propan-2-yl)-1H-pyrazol-3-yl]methyl}pentanoic acid hydrochloride structure
|
Common Name | 4-methyl-2-{[1-(propan-2-yl)-1H-pyrazol-3-yl]methyl}pentanoic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1864062-03-2 | Molecular Weight | 274.79 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H23ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methyl-2-{[1-(propan-2-yl)-1H-pyrazol-3-yl]methyl}pentanoic acid hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H23ClN2O2 |
|---|---|
| Molecular Weight | 274.79 |
| InChIKey | OVFFVXSEFWSKSF-UHFFFAOYSA-N |
| SMILES | CC(C)CC(Cc1ccn(C(C)C)n1)C(=O)O.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-methyl-2-{[1-(propan-2-yl)-1H-pyrazol-3-yl]methyl}pentanoic acid hydrochloride? |
| A: Molecular formula of 4-methyl-2-{[1-(propan-2-yl)-1H-pyrazol-3-yl]methyl}pentanoic acid hydrochloride is C13H23ClN2O2. |
| Q: What is the SMILES notation of 4-methyl-2-{[1-(propan-2-yl)-1H-pyrazol-3-yl]methyl}pentanoic acid hydrochloride? |
| A: SMILES notation of 4-methyl-2-{[1-(propan-2-yl)-1H-pyrazol-3-yl]methyl}pentanoic acid hydrochloride is CC(C)CC(Cc1ccn(C(C)C)n1)C(=O)O.Cl. |
| Q: What is the Chinese name of 1864062-03-2? |
| A: Chinese name of 1864062-03-2 is 1864062-03-2. |
| Q: What is the CAS number of 4-methyl-2-{[1-(propan-2-yl)-1H-pyrazol-3-yl]methyl}pentanoic acid hydrochloride? |
| A: CAS number of 4-methyl-2-{[1-(propan-2-yl)-1H-pyrazol-3-yl]methyl}pentanoic acid hydrochloride is 1864062-03-2. |
| Q: What is the InChIKey of 4-methyl-2-{[1-(propan-2-yl)-1H-pyrazol-3-yl]methyl}pentanoic acid hydrochloride? |
| A: InChIKey of 4-methyl-2-{[1-(propan-2-yl)-1H-pyrazol-3-yl]methyl}pentanoic acid hydrochloride is OVFFVXSEFWSKSF-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-methyl-2-{[1-(propan-2-yl)-1H-pyrazol-3-yl]methyl}pentanoic acid hydrochloride? |
| A: Molecular weight of 4-methyl-2-{[1-(propan-2-yl)-1H-pyrazol-3-yl]methyl}pentanoic acid hydrochloride is 274.79. |
| Q: What is the English name of 4-methyl-2-{[1-(propan-2-yl)-1H-pyrazol-3-yl]methyl}pentanoic acid hydrochloride? |
| A: The English name of 4-methyl-2-{[1-(propan-2-yl)-1H-pyrazol-3-yl]methyl}pentanoic acid hydrochloride is 4-methyl-2-{[1-(propan-2-yl)-1H-pyrazol-3-yl]methyl}pentanoic acid hydrochloride. |