1-(2-methoxyphenyl)-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride
Modify Date: 2026-08-04 07:58:42
1-(2-methoxyphenyl)-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride structure
|
Common Name | 1-(2-methoxyphenyl)-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1864063-92-2 | Molecular Weight | 304.73 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-methoxyphenyl)-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H13ClN2O3 |
|---|---|
| Molecular Weight | 304.73 |
| InChIKey | DYFOVYLRMVVNGS-UHFFFAOYSA-N |
| SMILES | COc1ccccc1-n1cnc2cc(C(=O)O)ccc21.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-(2-methoxyphenyl)-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride? |
| A: The English name of 1-(2-methoxyphenyl)-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride is 1-(2-methoxyphenyl)-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride. |
| Q: What is the InChIKey of 1-(2-methoxyphenyl)-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride? |
| A: InChIKey of 1-(2-methoxyphenyl)-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride is DYFOVYLRMVVNGS-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1864063-92-2? |
| A: Chinese name of 1864063-92-2 is 1864063-92-2. |
| Q: What is the SMILES notation of 1-(2-methoxyphenyl)-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride? |
| A: SMILES notation of 1-(2-methoxyphenyl)-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride is COc1ccccc1-n1cnc2cc(C(=O)O)ccc21.Cl. |
| Q: What is the molecular formula of 1-(2-methoxyphenyl)-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride? |
| A: Molecular formula of 1-(2-methoxyphenyl)-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride is C15H13ClN2O3. |
| Q: What is the CAS number of 1-(2-methoxyphenyl)-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride? |
| A: CAS number of 1-(2-methoxyphenyl)-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride is 1864063-92-2. |
| Q: What is the molecular weight of 1-(2-methoxyphenyl)-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride? |
| A: Molecular weight of 1-(2-methoxyphenyl)-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride is 304.73. |