[1-(2-phenylethyl)-1H-1,2,3-triazol-4-yl]methanol hydrochloride
Modify Date: 2026-09-28 20:49:01
![[1-(2-phenylethyl)-1H-1,2,3-triazol-4-yl]methanol hydrochloride Structure](https://www.chemsrc.com/extcaspic/023/1864073-20-0.png)
[1-(2-phenylethyl)-1H-1,2,3-triazol-4-yl]methanol hydrochloride structure
|
Common Name | [1-(2-phenylethyl)-1H-1,2,3-triazol-4-yl]methanol hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1864073-20-0 | Molecular Weight | 239.70 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [1-(2-phenylethyl)-1H-1,2,3-triazol-4-yl]methanol hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H14ClN3O |
|---|---|
| Molecular Weight | 239.70 |
| InChIKey | RMRYYNKDYACAMX-UHFFFAOYSA-N |
| SMILES | Cl.OCc1cn(CCc2ccccc2)nn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of [1-(2-phenylethyl)-1H-1,2,3-triazol-4-yl]methanol hydrochloride? |
| A: Molecular weight of [1-(2-phenylethyl)-1H-1,2,3-triazol-4-yl]methanol hydrochloride is 239.70. |
| Q: What is the molecular formula of [1-(2-phenylethyl)-1H-1,2,3-triazol-4-yl]methanol hydrochloride? |
| A: Molecular formula of [1-(2-phenylethyl)-1H-1,2,3-triazol-4-yl]methanol hydrochloride is C11H14ClN3O. |
| Q: What is the InChIKey of [1-(2-phenylethyl)-1H-1,2,3-triazol-4-yl]methanol hydrochloride? |
| A: InChIKey of [1-(2-phenylethyl)-1H-1,2,3-triazol-4-yl]methanol hydrochloride is RMRYYNKDYACAMX-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of [1-(2-phenylethyl)-1H-1,2,3-triazol-4-yl]methanol hydrochloride? |
| A: SMILES notation of [1-(2-phenylethyl)-1H-1,2,3-triazol-4-yl]methanol hydrochloride is Cl.OCc1cn(CCc2ccccc2)nn1. |
| Q: What is the English name of [1-(2-phenylethyl)-1H-1,2,3-triazol-4-yl]methanol hydrochloride? |
| A: The English name of [1-(2-phenylethyl)-1H-1,2,3-triazol-4-yl]methanol hydrochloride is [1-(2-phenylethyl)-1H-1,2,3-triazol-4-yl]methanol hydrochloride. |
| Q: What is the CAS number of [1-(2-phenylethyl)-1H-1,2,3-triazol-4-yl]methanol hydrochloride? |
| A: CAS number of [1-(2-phenylethyl)-1H-1,2,3-triazol-4-yl]methanol hydrochloride is 1864073-20-0. |
| Q: What is the Chinese name of 1864073-20-0? |
| A: Chinese name of 1864073-20-0 is 1864073-20-0. |