Sodium 4-methoxy-3,5-dimethylbenzene-1-sulfinate
Modify Date: 2026-07-10 14:37:54
Sodium 4-methoxy-3,5-dimethylbenzene-1-sulfinate structure
|
Common Name | Sodium 4-methoxy-3,5-dimethylbenzene-1-sulfinate | ||
|---|---|---|---|---|
| CAS Number | 1864487-80-8 | Molecular Weight | 222.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11NaO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sodium 4-methoxy-3,5-dimethylbenzene-1-sulfinate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H11NaO3S |
|---|---|
| Molecular Weight | 222.24 |
| InChIKey | LSSFAHNBLXTSSE-UHFFFAOYSA-M |
| SMILES | COc1c(C)cc(S(=O)[O-])cc1C.[Na+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Sodium 4-methoxy-3,5-dimethylbenzene-1-sulfinate? |
| A: CAS number of Sodium 4-methoxy-3,5-dimethylbenzene-1-sulfinate is 1864487-80-8. |
| Q: What is the English name of Sodium 4-methoxy-3,5-dimethylbenzene-1-sulfinate? |
| A: The English name of Sodium 4-methoxy-3,5-dimethylbenzene-1-sulfinate is Sodium 4-methoxy-3,5-dimethylbenzene-1-sulfinate. |
| Q: What is the molecular weight of Sodium 4-methoxy-3,5-dimethylbenzene-1-sulfinate? |
| A: Molecular weight of Sodium 4-methoxy-3,5-dimethylbenzene-1-sulfinate is 222.24. |
| Q: What is the SMILES notation of Sodium 4-methoxy-3,5-dimethylbenzene-1-sulfinate? |
| A: SMILES notation of Sodium 4-methoxy-3,5-dimethylbenzene-1-sulfinate is COc1c(C)cc(S(=O)[O-])cc1C.[Na+]. |
| Q: What is the InChIKey of Sodium 4-methoxy-3,5-dimethylbenzene-1-sulfinate? |
| A: InChIKey of Sodium 4-methoxy-3,5-dimethylbenzene-1-sulfinate is LSSFAHNBLXTSSE-UHFFFAOYSA-M. |
| Q: What is the Chinese name of 1864487-80-8? |
| A: Chinese name of 1864487-80-8 is 1864487-80-8. |
| Q: What is the molecular formula of Sodium 4-methoxy-3,5-dimethylbenzene-1-sulfinate? |
| A: Molecular formula of Sodium 4-methoxy-3,5-dimethylbenzene-1-sulfinate is C9H11NaO3S. |