4H-1-Benzopyran-4-one,7-hydroxy-3-methyl-2-phenyl- structure
|
Common Name | 4H-1-Benzopyran-4-one,7-hydroxy-3-methyl-2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 18651-15-5 | Molecular Weight | 252.26500 | |
| Density | 1.289g/cm3 | Boiling Point | 452.2ºC at 760mmHg | |
| Molecular Formula | C16H12O3 | Melting Point | 278ºC | |
| MSDS | N/A | Flash Point | 173.3ºC | |
| Name | 7-hydroxy-3-methyl-2-phenylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 452.2ºC at 760mmHg |
| Melting Point | 278ºC |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.26500 |
| Flash Point | 173.3ºC |
| Exact Mass | 252.07900 |
| PSA | 50.44000 |
| LogP | 3.47400 |
| Vapour Pressure | 8.57E-09mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | SUNCCQBNDWHMPR-UHFFFAOYSA-N |
| SMILES | Cc1c(-c2ccccc2)oc2cc(O)ccc2c1=O |
| HS Code | 2914400090 |
|---|
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 7-Hydroxy-3-methyl-2-phenyl-chromen-4-on |
| 3-methyl-7-hydroxyflavone |
| 7-hydroxy-3-methyl-2-phenyl-chromen-4-one |
| 7-hydroxy-3-methyl-2-phenylchromone |
| 7-Hydroxy-3-methylflavone |