[1,1'-Biphenyl]-4-ol,3-chloro-, 4-(N-methylcarbamate) structure
|
Common Name | [1,1'-Biphenyl]-4-ol,3-chloro-, 4-(N-methylcarbamate) | ||
|---|---|---|---|---|
| CAS Number | 18655-41-9 | Molecular Weight | 261.70400 | |
| Density | 1.227g/cm3 | Boiling Point | 380.5ºC at 760 mmHg | |
| Molecular Formula | C14H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.9ºC | |
| Name | (2-chloro-4-phenylphenyl) N-methylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.227g/cm3 |
|---|---|
| Boiling Point | 380.5ºC at 760 mmHg |
| Molecular Formula | C14H12ClNO2 |
| Molecular Weight | 261.70400 |
| Flash Point | 183.9ºC |
| Exact Mass | 261.05600 |
| PSA | 38.33000 |
| LogP | 4.11610 |
| Vapour Pressure | 5.42E-06mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | VGISKRVBGVAYIS-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1ccc(-c2ccccc2)cc1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-chlorobiphenyl-4-yl methylcarbamate |