(Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile
Modify Date: 2026-07-01 16:35:24
(Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile structure
|
Common Name | (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile | ||
|---|---|---|---|---|
| CAS Number | 18656-85-4 | Molecular Weight | 350.36800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H18N2O4 |
|---|---|
| Molecular Weight | 350.36800 |
| Exact Mass | 350.12700 |
| PSA | 84.50000 |
| LogP | 3.67896 |
| Vapour Pressure | 2.1E-10mmHg at 25°C |
| InChIKey | JZMXUBVLKMFTGE-NXVVXOECSA-N |
| SMILES | COc1ccc(C(C#N)=C(C#N)c2ccc(OC)c(OC)c2)cc1OC |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:119755-10-1This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile? |
| A: LogP of (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile is 3.67896. |
| Q: What is the molecular formula of (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile? |
| A: Molecular formula of (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile is C20H18N2O4. |
| Q: What are the downstream products of (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile? |
| A: Related downstream products(CAS) of (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile: 119755-10-1. |
| Q: What is the Chinese name of 18656-85-4? |
| A: Chinese name of 18656-85-4 is 18656-85-4. |
| Q: What is the English name of (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile? |
| A: The English name of (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile is (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile. |
| Q: What is the CAS number of (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile? |
| A: CAS number of (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile is 18656-85-4. |
| Q: What is the molecular weight of (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile? |
| A: Molecular weight of (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile is 350.36800. |
| Q: What is the InChIKey of (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile? |
| A: InChIKey of (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile is JZMXUBVLKMFTGE-NXVVXOECSA-N. |
| Q: What is the SMILES notation of (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile? |
| A: SMILES notation of (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile is COc1ccc(C(C#N)=C(C#N)c2ccc(OC)c(OC)c2)cc1OC. |
| Q: What is the polar surface area (PSA) of (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile? |
| A: Polar surface area (PSA) of (Z)-2,3-bis(3,4-dimethoxyphenyl)but-2-enedinitrile is 84.50000. |