Methylcarbamic acid 4-(dimethylamino)-5-methyl-2-(1-methylethyl)phenyl ester structure
|
Common Name | Methylcarbamic acid 4-(dimethylamino)-5-methyl-2-(1-methylethyl)phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 18659-45-5 | Molecular Weight | 250.33700 | |
| Density | 1.042g/cm3 | Boiling Point | 342.9ºC at 760 mmHg | |
| Molecular Formula | C14H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.2ºC | |
| Name | [2-(dimethylamino)-3-methyl-6-propan-2-ylphenyl] N-methylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.042g/cm3 |
|---|---|
| Boiling Point | 342.9ºC at 760 mmHg |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.33700 |
| Flash Point | 161.2ºC |
| Exact Mass | 250.16800 |
| PSA | 45.06000 |
| LogP | 3.10700 |
| Vapour Pressure | 7.28E-05mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | BVSKMTSQXJSFKQ-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1c(C(C)C)ccc(C)c1N(C)C |
| HS Code | 2924299090 |
|---|
|
~%
Methylcarbamic ... CAS#:18659-45-5 |
| Literature: Stevens; Beutel Journal of the American Chemical Society, 1941 , vol. 63, p. 308,309 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 6-Dimethylamino-3-methylcarbamoyloxy-p-cymol |
| Fisons NC-1493 |
| NC 1493 |
| ENT 27,338 |