(1S,2S)-1,2-Bis(2,4,6-trimethylphenyl)ethylenediamine structure
|
Common Name | (1S,2S)-1,2-Bis(2,4,6-trimethylphenyl)ethylenediamine | ||
|---|---|---|---|---|
| CAS Number | 186769-18-6 | Molecular Weight | 296.45000 | |
| Density | 1.024g/cm3 | Boiling Point | 451.7ºC at 760 mmHg | |
| Molecular Formula | C20H28N2 | Melting Point | >300ºC | |
| MSDS | N/A | Flash Point | 272.3ºC | |
| Name | (1S,2S)-1,2-bis(2,4,6-trimethylphenyl)ethane-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.024g/cm3 |
|---|---|
| Boiling Point | 451.7ºC at 760 mmHg |
| Melting Point | >300ºC |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.45000 |
| Flash Point | 272.3ºC |
| Exact Mass | 296.22500 |
| PSA | 52.04000 |
| LogP | 5.63740 |
| Vapour Pressure | 2.37E-08mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | ILMRHFMYIXTNMC-PMACEKPBSA-N |
| SMILES | Cc1cc(C)c(C(N)C(N)c2c(C)cc(C)cc2C)c(C)c1 |
| HS Code | 2921290000 |
|---|
| HS Code | 2921290000 |
|---|---|
| Summary | 2921290000 other acyclic polyamines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| B2317 |
| MFCD10566991 |
| (1S,2S)-1,2-Dimesitylethylenediamine |
| (1S,2S)-1,2-BIS(2,4,6-TRIMETHYLPHENYL)ETHYLENEDIAMINE |