1,4-Bis(trimethylstannyl)-2,3,5,6-tetrachlorobenzene structure
|
Common Name | 1,4-Bis(trimethylstannyl)-2,3,5,6-tetrachlorobenzene | ||
|---|---|---|---|---|
| CAS Number | 18689-05-9 | Molecular Weight | 547.53300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H24Cl4Sn2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-(2,3,5,6-tetrachloro-4-trimethylstannylphenyl)stannane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H24Cl4Sn2 |
|---|---|
| Molecular Weight | 547.53300 |
| Exact Mass | 547.86800 |
| LogP | 6.74360 |
| InChIKey | ZVEMBBMVWPYMQX-UHFFFAOYSA-N |
| SMILES | C[Sn](C)(C)c1c(Cl)c(Cl)c([Sn](C)(C)C)c(Cl)c1Cl |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1,4-Bis-<trimethylstannyl>-tetrachlorbenzol |