Acetone,O-[(2,5-dichlorophenyl)carbamoyl]oxime (7CI,8CI)
Modify Date: 2025-09-08 13:08:31
![Acetone,O-[(2,5-dichlorophenyl)carbamoyl]oxime (7CI,8CI) Structure](https://image.chemsrc.com/caspic/248/18699-10-0.png)
Acetone,O-[(2,5-dichlorophenyl)carbamoyl]oxime (7CI,8CI) structure
|
Common Name | Acetone,O-[(2,5-dichlorophenyl)carbamoyl]oxime (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 18699-10-0 | Molecular Weight | 261.10500 | |
| Density | 1.33g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H10Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (propan-2-ylideneamino) N-(2,5-dichlorophenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Molecular Formula | C10H10Cl2N2O2 |
| Molecular Weight | 261.10500 |
| Exact Mass | 260.01200 |
| PSA | 50.69000 |
| LogP | 4.01070 |
| Index of Refraction | 1.561 |
| InChIKey | LZWKPDUHFQWOQL-UHFFFAOYSA-N |
| SMILES | CC(C)=NOC(=O)Nc1cc(Cl)ccc1Cl |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| [(2,5-dichlorophenyl)amino][(propan-2-ylideneamino)oxy]methanone |