Phenyl 3,4,6-Tri-O-acetyl-2-deoxy-1-thio-2-(2,2,2-trichloroethoxyformamido)-beta-D-glucopyranoside structure
|
Common Name | Phenyl 3,4,6-Tri-O-acetyl-2-deoxy-1-thio-2-(2,2,2-trichloroethoxyformamido)-beta-D-glucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 187022-49-7 | Molecular Weight | 572.84100 | |
| Density | 1.457g/cm3 | Boiling Point | 633.127ºC at 760 mmHg | |
| Molecular Formula | C21H24Cl3NO9S | Melting Point | 143 °C | |
| MSDS | N/A | Flash Point | 336.703ºC | |
| Name | [(2S,3S,4R,5S,6S)-3,4-diacetyloxy-6-phenylsulfanyl-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.457g/cm3 |
|---|---|
| Boiling Point | 633.127ºC at 760 mmHg |
| Melting Point | 143 °C |
| Molecular Formula | C21H24Cl3NO9S |
| Molecular Weight | 572.84100 |
| Flash Point | 336.703ºC |
| Exact Mass | 571.02400 |
| PSA | 155.25000 |
| LogP | 3.59950 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | AZDNCEYOFMNMSH-QTMHVTGLSA-N |
| SMILES | CC(=O)OCC1OC(Sc2ccccc2)C(NC(=O)OCC(Cl)(Cl)Cl)C(OC(C)=O)C1OC(C)=O |
|
~95%
Phenyl 3,4,6-Tr... CAS#:187022-49-7 |
| Literature: Zhang, Zhiyuan; Magnusson, Goeran Carbohydrate Research, 1996 , vol. 295, p. 41 - 55 |
|
~%
Detail
|
| Literature: Yan, Fengyang; Mehta, Seema; Eichler, Eva; Wakarchuk, Warren W.; Gilbert, Michel; Schur, Melissa J.; Whitfield, Dennis M. Journal of Organic Chemistry, 2003 , vol. 68, # 6 p. 2426 - 2431 |
| MFCD11112181 |
| P1866 |
| Phenyl 3,4,6-Tri-O-acetyl-2-deoxy-1-thio-2-(2,2,2-trichloroethoxyforMaMido)-β-D-glucopyranoside |