Acetamide,2-(3-chlorophenoxy)-N-phenyl- structure
|
Common Name | Acetamide,2-(3-chlorophenoxy)-N-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 18705-06-1 | Molecular Weight | 261.70400 | |
| Density | 1.29g/cm3 | Boiling Point | 473.5ºC at 760mmHg | |
| Molecular Formula | C14H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.2ºC | |
| Name | 2-(3-chlorophenoxy)-N-phenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 473.5ºC at 760mmHg |
| Molecular Formula | C14H12ClNO2 |
| Molecular Weight | 261.70400 |
| Flash Point | 240.2ºC |
| Exact Mass | 261.05600 |
| PSA | 38.33000 |
| LogP | 3.43050 |
| Vapour Pressure | 3.91E-09mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | LKKOPZJMZVQMGY-UHFFFAOYSA-N |
| SMILES | O=C(COc1cccc(Cl)c1)Nc1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (3-Chlor-phenoxy)-essigsaeure-anilid |
| (3-chloro-phenoxy)-acetic acid anilide |