2-Pyridinamine, N-(2-bromo-2-propen-1-yl)-5-(methylsulfonyl)
Modify Date: 2025-11-19 12:42:47
2-Pyridinamine, N-(2-bromo-2-propen-1-yl)-5-(methylsulfonyl) structure
|
Common Name | 2-Pyridinamine, N-(2-bromo-2-propen-1-yl)-5-(methylsulfonyl) | ||
|---|---|---|---|---|
| CAS Number | 1871000-16-6 | Molecular Weight | 291.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11BrN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Pyridinamine, N-(2-bromo-2-propen-1-yl)-5-(methylsulfonyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H11BrN2O2S |
|---|---|
| Molecular Weight | 291.17 |
| InChIKey | JMDKSGPEYQSBML-UHFFFAOYSA-N |
| SMILES | C=C(Br)CNc1ccc(S(C)(=O)=O)cn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-Pyridinamine, N-(2-bromo-2-propen-1-yl)-5-(methylsulfonyl)? |
| A: Molecular weight of 2-Pyridinamine, N-(2-bromo-2-propen-1-yl)-5-(methylsulfonyl) is 291.17. |
| Q: What is the InChIKey of 2-Pyridinamine, N-(2-bromo-2-propen-1-yl)-5-(methylsulfonyl)? |
| A: InChIKey of 2-Pyridinamine, N-(2-bromo-2-propen-1-yl)-5-(methylsulfonyl) is JMDKSGPEYQSBML-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-Pyridinamine, N-(2-bromo-2-propen-1-yl)-5-(methylsulfonyl)? |
| A: CAS number of 2-Pyridinamine, N-(2-bromo-2-propen-1-yl)-5-(methylsulfonyl) is 1871000-16-6. |
| Q: What is the English name of 2-Pyridinamine, N-(2-bromo-2-propen-1-yl)-5-(methylsulfonyl)? |
| A: The English name of 2-Pyridinamine, N-(2-bromo-2-propen-1-yl)-5-(methylsulfonyl) is 2-Pyridinamine, N-(2-bromo-2-propen-1-yl)-5-(methylsulfonyl). |
| Q: What is the molecular formula of 2-Pyridinamine, N-(2-bromo-2-propen-1-yl)-5-(methylsulfonyl)? |
| A: Molecular formula of 2-Pyridinamine, N-(2-bromo-2-propen-1-yl)-5-(methylsulfonyl) is C9H11BrN2O2S. |
| Q: What is the SMILES notation of 2-Pyridinamine, N-(2-bromo-2-propen-1-yl)-5-(methylsulfonyl)? |
| A: SMILES notation of 2-Pyridinamine, N-(2-bromo-2-propen-1-yl)-5-(methylsulfonyl) is C=C(Br)CNc1ccc(S(C)(=O)=O)cn1. |
| Q: What is the Chinese name of 1871000-16-6? |
| A: Chinese name of 1871000-16-6 is 1871000-16-6. |