1-METHYL-5-NITROINDOLINE structure
|
Common Name | 1-METHYL-5-NITROINDOLINE | ||
|---|---|---|---|---|
| CAS Number | 18711-25-6 | Molecular Weight | 178.18800 | |
| Density | 1.259g/cm3 | Boiling Point | 334.7ºC at 760mmHg | |
| Molecular Formula | C9H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.2ºC | |
| Name | 1-methyl-5-nitro-2,3-dihydroindole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.259g/cm3 |
|---|---|
| Boiling Point | 334.7ºC at 760mmHg |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.18800 |
| Flash Point | 156.2ºC |
| Exact Mass | 178.07400 |
| PSA | 49.06000 |
| LogP | 2.17530 |
| Vapour Pressure | 0.000126mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | VNTWOKSFYDNPED-UHFFFAOYSA-N |
| SMILES | CN1CCc2cc([N+](=O)[O-])ccc21 |
| HS Code | 2933990090 |
|---|
|
~92%
1-METHYL-5-NITR... CAS#:18711-25-6 |
| Literature: F2G LTD Patent: WO2006/123145 A1, 2006 ; Location in patent: Page/Page column 48; 50 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-methyl-5-nitroindoline |
| 1H-Indole,2,3-dihydro-1-methyl-5-nitro |
| N-methyl-5-nitroindoline |
| 1-Methyl-5-nitro-2,3-dihydro-1H-indole |
| 1-methyl-5-nitro-2,3-dihydro-indole |