tert-butylazanium,perchlorate structure
|
Common Name | tert-butylazanium,perchlorate | ||
|---|---|---|---|---|
| CAS Number | 18720-49-5 | Molecular Weight | 173.59500 | |
| Density | N/A | Boiling Point | 44.4ºC at 760mmHg | |
| Molecular Formula | C4H12ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butylazanium,perchlorate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 44.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C4H12ClNO4 |
| Molecular Weight | 173.59500 |
| Exact Mass | 173.04500 |
| PSA | 97.46000 |
| LogP | 1.60020 |
| Vapour Pressure | 363mmHg at 25°C |
| InChIKey | BKIDJIYDGSCJCR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[NH3+].[O-][Cl+3]([O-])([O-])[O-] |
|
~%
tert-butylazani... CAS#:18720-49-5 |
| Literature: Joseph, V. Bernadette; Satchell, Derek P. N.; Satchell, Rosemary S.; Wassef, Wasfy N. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1992 , # 3 p. 339 - 342 |
| tert-butylammonium perchlorate |
| tert-butylazanium perchlorate |
| 2-methylpropan-2-aminium perchlorate |
| tert-Butylamine perchlorate |