CHEMPACIFIC 38209 structure
|
Common Name | CHEMPACIFIC 38209 | ||
|---|---|---|---|---|
| CAS Number | 187242-90-6 | Molecular Weight | 163.13300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methyl-3-nitropyridine-2-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H5N3O2 |
|---|---|
| Molecular Weight | 163.13300 |
| Exact Mass | 163.03800 |
| PSA | 82.50000 |
| LogP | 1.69308 |
| InChIKey | WJDGIPJZTYZBTJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])c(C#N)n1 |
| Storage condition | 2-8℃ |
| HS Code | 2933399090 |
|---|
|
~49%
CHEMPACIFIC 38209 CAS#:187242-90-6 |
| Literature: Troschutz; Karger Journal of Heterocyclic Chemistry, 1996 , vol. 33, # 6 p. 1815 - 1821 |
|
~%
CHEMPACIFIC 38209 CAS#:187242-90-6 |
| Literature: Troschutz; Karger Journal of Heterocyclic Chemistry, 1996 , vol. 33, # 6 p. 1815 - 1821 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-METHYL-3-NITROPICOLINONITRILE |
| 6-METHYL-3-NITRO-2-PYRIDINECARBONITRILE |
| 6-methyl-3-nitro-pyridine-2-carbonitrile |
| 2-CYANO-6-METHYL-3-NITRO-PYRIDINE |