(2-hydroxyphenyl)-(4-methoxyphenyl)methanone structure
|
Common Name | (2-hydroxyphenyl)-(4-methoxyphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 18733-07-8 | Molecular Weight | 228.24300 | |
| Density | 1.201g/cm3 | Boiling Point | 360.8ºC at 760mmHg | |
| Molecular Formula | C14H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.1ºC | |
| Name | (2-hydroxyphenyl)-(4-methoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.201g/cm3 |
|---|---|
| Boiling Point | 360.8ºC at 760mmHg |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.24300 |
| Flash Point | 136.1ºC |
| Exact Mass | 228.07900 |
| PSA | 46.53000 |
| LogP | 2.63180 |
| Vapour Pressure | 1.05E-05mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | MPOIUZCYWIPYNC-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2ccccc2O)cc1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Hydroxy-4-methoxy-benzophenon |
| 4'-methoxy-2-hydroxybenzophenone |
| 2-Hydroxy-4'-methoxybenzophenone |
| Benzophenone,2-hydroxy-4'-methoxy |