2-(2-hydroxy-2,2-diphenyl-ethyl)sulfinyl-1,1-diphenyl-ethanol structure
|
Common Name | 2-(2-hydroxy-2,2-diphenyl-ethyl)sulfinyl-1,1-diphenyl-ethanol | ||
|---|---|---|---|---|
| CAS Number | 18738-55-1 | Molecular Weight | 442.56900 | |
| Density | 1.27g/cm3 | Boiling Point | 716.7ºC at 760 mmHg | |
| Molecular Formula | C28H26O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 387.2ºC | |
| Name | 2,2'-sulfinylbis(1,1-diphenylethan-1-ol) |
|---|
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 716.7ºC at 760 mmHg |
| Molecular Formula | C28H26O3S |
| Molecular Weight | 442.56900 |
| Flash Point | 387.2ºC |
| Exact Mass | 442.16000 |
| PSA | 76.74000 |
| LogP | 5.47300 |
| Vapour Pressure | 1.47E-21mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | UAIGPZLIDQCZEY-UHFFFAOYSA-N |
| SMILES | O=S(CC(O)(c1ccccc1)c1ccccc1)CC(O)(c1ccccc1)c1ccccc1 |
|
~%
2-(2-hydroxy-2,... CAS#:18738-55-1 |
| Literature: Kaiser,E.M. et al. Journal of Organometallic Chemistry, 1973 , vol. 59, p. 53 - 64 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |