p-Hydroxy Phenobarbital Glucuronide
Modify Date: 2026-08-11 15:35:28
p-Hydroxy Phenobarbital Glucuronide structure
|
Common Name | p-Hydroxy Phenobarbital Glucuronide | ||
|---|---|---|---|---|
| CAS Number | 18743-41-4 | Molecular Weight | 424.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20N2O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | p-Hydroxy Phenobarbital Glucuronide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H20N2O10 |
|---|---|
| Molecular Weight | 424.4 |
| InChIKey | RQTUXVFRLKPUJG-BYNIDDHOSA-N |
| SMILES | CCC1(c2ccc(OC3OC(C(=O)O)C(O)C(O)C3O)cc2)C(=O)NC(=O)NC1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of p-Hydroxy Phenobarbital Glucuronide? |
| A: SMILES notation of p-Hydroxy Phenobarbital Glucuronide is CCC1(c2ccc(OC3OC(C(=O)O)C(O)C(O)C3O)cc2)C(=O)NC(=O)NC1=O. |
| Q: What is the Chinese name of 18743-41-4? |
| A: Chinese name of 18743-41-4 is 18743-41-4. |
| Q: What is the InChIKey of p-Hydroxy Phenobarbital Glucuronide? |
| A: InChIKey of p-Hydroxy Phenobarbital Glucuronide is RQTUXVFRLKPUJG-BYNIDDHOSA-N. |
| Q: What is the English name of p-Hydroxy Phenobarbital Glucuronide? |
| A: The English name of p-Hydroxy Phenobarbital Glucuronide is p-Hydroxy Phenobarbital Glucuronide. |
| Q: What is the CAS number of p-Hydroxy Phenobarbital Glucuronide? |
| A: CAS number of p-Hydroxy Phenobarbital Glucuronide is 18743-41-4. |
| Q: What is the molecular formula of p-Hydroxy Phenobarbital Glucuronide? |
| A: Molecular formula of p-Hydroxy Phenobarbital Glucuronide is C18H20N2O10. |
| Q: What is the molecular weight of p-Hydroxy Phenobarbital Glucuronide? |
| A: Molecular weight of p-Hydroxy Phenobarbital Glucuronide is 424.4. |