Benzene,1,1',1'',1'''-(silanetetrayltetrakis-2,1-ethynediyl)tetrakis- structure
|
Common Name | Benzene,1,1',1'',1'''-(silanetetrayltetrakis-2,1-ethynediyl)tetrakis- | ||
|---|---|---|---|---|
| CAS Number | 18769-86-3 | Molecular Weight | 432.58700 | |
| Density | 1.17g/cm3 | Boiling Point | 562.1ºC at 760mmHg | |
| Molecular Formula | C32H20Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.3ºC | |
| Name | tetrakis(2-phenylethynyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 562.1ºC at 760mmHg |
| Molecular Formula | C32H20Si |
| Molecular Weight | 432.58700 |
| Flash Point | 279.3ºC |
| Exact Mass | 432.13300 |
| LogP | 5.79880 |
| Vapour Pressure | 4.39E-12mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | WMHYYXOHVQKQLL-UHFFFAOYSA-N |
| SMILES | C(#C[Si](C#Cc1ccccc1)(C#Cc1ccccc1)C#Cc1ccccc1)c1ccccc1 |
|
~81%
Benzene,1,1',1'... CAS#:18769-86-3 |
| Literature: Kim, Chungkyun; Kim, Moon Journal of Organometallic Chemistry, 1998 , vol. 563, # 1-2 p. 43 - 51 |
|
~76%
Benzene,1,1',1'... CAS#:18769-86-3 |
| Literature: Koester, Roland; Seidel, Guenter; Klopp, Ingo; Krueger, Carl; Kehr, Gerald; et al. Chemische Berichte, 1993 , vol. 126, # 6 p. 1385 - 1396 |
|
~%
Benzene,1,1',1'... CAS#:18769-86-3 |
| Literature: Teng, Zhu; Boss, Christoph; Keese, Reinhart Tetrahedron, 1997 , vol. 53, # 38 p. 12979 - 12990 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Tetrakis-phenylaethinyl-silan |