1-(5-bromo-7-ethyl-2-benzofuryl)-2-chloroethan-1-one structure
|
Common Name | 1-(5-bromo-7-ethyl-2-benzofuryl)-2-chloroethan-1-one | ||
|---|---|---|---|---|
| CAS Number | 18775-40-1 | Molecular Weight | 301.56400 | |
| Density | 1.521g/cm3 | Boiling Point | 387.2ºC at 760 mmHg | |
| Molecular Formula | C12H10BrClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188ºC | |
| Name | 1-(5-Bromo-7-ethyl-1-benzofuran-2-yl)-2-chloroethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.521g/cm3 |
|---|---|
| Boiling Point | 387.2ºC at 760 mmHg |
| Molecular Formula | C12H10BrClO2 |
| Molecular Weight | 301.56400 |
| Flash Point | 188ºC |
| Exact Mass | 299.95500 |
| PSA | 30.21000 |
| LogP | 4.17920 |
| Vapour Pressure | 3.35E-06mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | SYSQCQYOHVPKJZ-UHFFFAOYSA-N |
| SMILES | CCc1cc(Br)cc2cc(C(=O)CCl)oc12 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 242-563-7 |