({[3-(Bromomethyl)-4,4-dimethylpentyl]oxy}methyl)benzene
Modify Date: 2025-09-10 20:16:08
![({[3-(Bromomethyl)-4,4-dimethylpentyl]oxy}methyl)benzene Structure](https://www.chemsrc.com/extcaspic/315/1878094-02-0.png)
({[3-(Bromomethyl)-4,4-dimethylpentyl]oxy}methyl)benzene structure
|
Common Name | ({[3-(Bromomethyl)-4,4-dimethylpentyl]oxy}methyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 1878094-02-0 | Molecular Weight | 299.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ({[3-(Bromomethyl)-4,4-dimethylpentyl]oxy}methyl)benzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H23BrO |
|---|---|
| Molecular Weight | 299.25 |
| InChIKey | FWUGASSHEBRRTE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(CBr)CCOCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of ({[3-(Bromomethyl)-4,4-dimethylpentyl]oxy}methyl)benzene? |
| A: Molecular weight of ({[3-(Bromomethyl)-4,4-dimethylpentyl]oxy}methyl)benzene is 299.25. |
| Q: What is the molecular formula of ({[3-(Bromomethyl)-4,4-dimethylpentyl]oxy}methyl)benzene? |
| A: Molecular formula of ({[3-(Bromomethyl)-4,4-dimethylpentyl]oxy}methyl)benzene is C15H23BrO. |
| Q: What is the English name of ({[3-(Bromomethyl)-4,4-dimethylpentyl]oxy}methyl)benzene? |
| A: The English name of ({[3-(Bromomethyl)-4,4-dimethylpentyl]oxy}methyl)benzene is ({[3-(Bromomethyl)-4,4-dimethylpentyl]oxy}methyl)benzene. |
| Q: What is the InChIKey of ({[3-(Bromomethyl)-4,4-dimethylpentyl]oxy}methyl)benzene? |
| A: InChIKey of ({[3-(Bromomethyl)-4,4-dimethylpentyl]oxy}methyl)benzene is FWUGASSHEBRRTE-UHFFFAOYSA-N. |
| Q: What is the CAS number of ({[3-(Bromomethyl)-4,4-dimethylpentyl]oxy}methyl)benzene? |
| A: CAS number of ({[3-(Bromomethyl)-4,4-dimethylpentyl]oxy}methyl)benzene is 1878094-02-0. |
| Q: What is the Chinese name of 1878094-02-0? |
| A: Chinese name of 1878094-02-0 is 1878094-02-0. |
| Q: What is the SMILES notation of ({[3-(Bromomethyl)-4,4-dimethylpentyl]oxy}methyl)benzene? |
| A: SMILES notation of ({[3-(Bromomethyl)-4,4-dimethylpentyl]oxy}methyl)benzene is CC(C)(C)C(CBr)CCOCc1ccccc1. |