Benzeneacetonitrile, a-hydroxy-a-[(3-methoxyphenoxy)methyl]- structure
|
Common Name | Benzeneacetonitrile, a-hydroxy-a-[(3-methoxyphenoxy)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 18787-04-7 | Molecular Weight | 269.29500 | |
| Density | 1.208g/cm3 | Boiling Point | 490.4ºC at 760mmHg | |
| Molecular Formula | C16H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.4ºC | |
| Name | 2-hydroxy-3-(3-methoxyphenoxy)-2-phenylpropanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.208g/cm3 |
|---|---|
| Boiling Point | 490.4ºC at 760mmHg |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.29500 |
| Flash Point | 250.4ºC |
| Exact Mass | 269.10500 |
| PSA | 62.48000 |
| LogP | 2.48538 |
| Vapour Pressure | 1.96E-10mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | VPHWMIVTJMMPDO-UHFFFAOYSA-N |
| SMILES | COc1cccc(OCC(O)(C#N)c2ccccc2)c1 |
|
~%
Benzeneacetonit... CAS#:18787-04-7 |
| Literature: Baker; Pollard; Robinson Journal of the Chemical Society, 1929 , p. 1470 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-hydroxy-3-(3-methoxy-phenoxy)-2-phenyl-propionitrile |