(2S)-2-amino-5-(1-aminobutylideneamino)pentanoic acid
Modify Date: 2026-06-25 13:15:15
(2S)-2-amino-5-(1-aminobutylideneamino)pentanoic acid structure
|
Common Name | (2S)-2-amino-5-(1-aminobutylideneamino)pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 187883-75-6 | Molecular Weight | 201.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S)-2-amino-5-(1-aminobutylideneamino)pentanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H19N3O2 |
|---|---|
| Molecular Weight | 201.27 |
| InChIKey | KRILJVOCVSUPMA-ZETCQYMHSA-N |
| SMILES | CCCC(=NCCC[C@@H](C(=O)O)N)N |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Hemoglobin Assay from Article 10.1021/acs.biochem.5b00135: "Mechanistic studies of in...
Source: BindingDB
Target: N/A
External Id: BindingDB_6799_1
|
|
Name: Inhibition of nNOS assessed as conversion of L-[3H]arginine to L-[3H]citrulline
Source: ChEMBL
Target: Nitric oxide synthase, brain
External Id: CHEMBL1002712
|
|
Name: Inhibition of human recombinant eNOS at 1 uM
Source: ChEMBL
Target: Nitric oxide synthase, endothelial
External Id: CHEMBL1020501
|
|
Name: Inhibition of human recombinant iNOS at 100 uM
Source: ChEMBL
Target: Nitric oxide synthase, inducible
External Id: CHEMBL1020502
|
|
Name: Inhibition of human recombinant iNOS at 1 uM
Source: ChEMBL
Target: Nitric oxide synthase, inducible
External Id: CHEMBL1020499
|
|
Name: Inhibition of human recombinant nNOS at 1 uM
Source: ChEMBL
Target: Nitric oxide synthase, brain
External Id: CHEMBL1020500
|
|
Name: In Vitro hDDAH-1 Assay from Article 10.3109/14756366.2011.573480: "Designing modulato...
Source: BindingDB
Target: N/A
External Id: BindingDB_8172_1
|
|
Name: Inhibition of human recombinant nNOS at 100 uM
Source: ChEMBL
Target: Nitric oxide synthase, brain
External Id: CHEMBL1020497
|
|
Name: Inhibition of human recombinant eNOS at 100 uM
Source: ChEMBL
Target: Nitric oxide synthase, endothelial
External Id: CHEMBL1020498
|
|
Name: Inhibition of human DDAH1 at 1 mM by HPLC
Source: ChEMBL
Target: N(G),N(G)-dimethylarginine dimethylaminohydrolase 1
External Id: CHEMBL1020493
|
Total 10, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (2S)-2-amino-5-(1-aminobutylideneamino)pentanoic acid? |
| A: Molecular formula of (2S)-2-amino-5-(1-aminobutylideneamino)pentanoic acid is C9H19N3O2. |
| Q: What is the molecular weight of (2S)-2-amino-5-(1-aminobutylideneamino)pentanoic acid? |
| A: Molecular weight of (2S)-2-amino-5-(1-aminobutylideneamino)pentanoic acid is 201.27. |
| Q: What is the Chinese name of 187883-75-6? |
| A: Chinese name of 187883-75-6 is 187883-75-6. |
| Q: What is the InChIKey of (2S)-2-amino-5-(1-aminobutylideneamino)pentanoic acid? |
| A: InChIKey of (2S)-2-amino-5-(1-aminobutylideneamino)pentanoic acid is KRILJVOCVSUPMA-ZETCQYMHSA-N. |
| Q: What is the English name of (2S)-2-amino-5-(1-aminobutylideneamino)pentanoic acid? |
| A: The English name of (2S)-2-amino-5-(1-aminobutylideneamino)pentanoic acid is (2S)-2-amino-5-(1-aminobutylideneamino)pentanoic acid. |
| Q: What is the CAS number of (2S)-2-amino-5-(1-aminobutylideneamino)pentanoic acid? |
| A: CAS number of (2S)-2-amino-5-(1-aminobutylideneamino)pentanoic acid is 187883-75-6. |
| Q: What is the SMILES notation of (2S)-2-amino-5-(1-aminobutylideneamino)pentanoic acid? |
| A: SMILES notation of (2S)-2-amino-5-(1-aminobutylideneamino)pentanoic acid is CCCC(=NCCC[C@@H](C(=O)O)N)N. |