ethyl 2-[(4-methoxyphenyl)hydrazinylidene]-3-oxobutanoate structure
|
Common Name | ethyl 2-[(4-methoxyphenyl)hydrazinylidene]-3-oxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 18794-95-1 | Molecular Weight | 264.27700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-[(4-methoxyphenyl)hydrazinylidene]-3-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H16N2O4 |
|---|---|
| Molecular Weight | 264.27700 |
| Exact Mass | 264.11100 |
| PSA | 76.99000 |
| LogP | 1.68820 |
| InChIKey | MFDAYPUMYVAJLG-IDKACCCPSA-N |
| SMILES | CCOC(=O)C(N=Nc1ccc(OC)cc1)=C(C)O |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2,3-Dioxo-buttersaeure-aethylester-p-anisylhydrazon |
| 4-methoxyphenyl-hydrazono-ethyl-2,3-dioxobutyrate |