Decanoic acid 2,2,3,3,4,4,5,5-octafluoropentyl ester
Modify Date: 2025-08-25 12:49:17
Decanoic acid 2,2,3,3,4,4,5,5-octafluoropentyl ester structure
|
Common Name | Decanoic acid 2,2,3,3,4,4,5,5-octafluoropentyl ester | ||
|---|---|---|---|---|
| CAS Number | 18798-10-2 | Molecular Weight | 386.32100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22F8O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,3,3,4,4,5,5-octafluoropentyl decanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H22F8O2 |
|---|---|
| Molecular Weight | 386.32100 |
| Exact Mass | 386.14900 |
| PSA | 26.30000 |
| LogP | 5.84130 |
| InChIKey | UAYJPUNXOMATLD-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Decanoic acid 2,2,3,3,4,4,5,5-octafluoropentyl ester |
| 1,1,5-Trihydroperfluoropentyl decanoate |