17-oxodexamethasone structure
|
Common Name | 17-oxodexamethasone | ||
|---|---|---|---|---|
| CAS Number | 1880-61-1 | Molecular Weight | 332.40900 | |
| Density | 1.23g/cm3 | Boiling Point | 478.8ºC at 760mmHg | |
| Molecular Formula | C20H25FO3 | Melting Point | 242-244ºC | |
| MSDS | N/A | Flash Point | 243.4ºC | |
| Name | 17-oxodexamethasone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 478.8ºC at 760mmHg |
| Melting Point | 242-244ºC |
| Molecular Formula | C20H25FO3 |
| Molecular Weight | 332.40900 |
| Flash Point | 243.4ºC |
| Exact Mass | 332.17900 |
| PSA | 54.37000 |
| LogP | 3.17230 |
| Vapour Pressure | 3.54E-11mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | IZLVPOBNINIXJM-FETOPEPRSA-N |
| SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1=O |
|
~71%
17-oxodexamethasone CAS#:1880-61-1 |
| Literature: Pinto, Rui M. A.; Salvador, Jorge A. R.; Le Roux, Christophe; Paixao, Jose A. Journal of Organic Chemistry, 2009 , vol. 74, # 21 p. 8488 - 8491 |
|
~15%
17-oxodexamethasone CAS#:1880-61-1
Detail
|
| Literature: Steroids, , vol. 46, # 1 p. 665 - 676 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 9-Fluoro-11b-hydroxy-16a-methyl Androsta-1,4-diene-3,17-dione |
| 9-Fluoro-11-hydroxy-16a-methyl Androsta-1,4-diene-3,17-dione |
| 9alpha-Fluoro-11beta-hydroxy-16alpha-methyl-1,4-androstadiene-3,17-dio ne |