[(4-chlorophenyl)methylideneamino] benzoate structure
|
Common Name | [(4-chlorophenyl)methylideneamino] benzoate | ||
|---|---|---|---|---|
| CAS Number | 18802-67-0 | Molecular Weight | 259.68800 | |
| Density | 1.18g/cm3 | Boiling Point | 373.7ºC at 760 mmHg | |
| Molecular Formula | C14H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.8ºC | |
| Name | [(4-chlorophenyl)methylideneamino] benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 373.7ºC at 760 mmHg |
| Molecular Formula | C14H10ClNO2 |
| Molecular Weight | 259.68800 |
| Flash Point | 179.8ºC |
| Exact Mass | 259.04000 |
| PSA | 38.66000 |
| LogP | 3.53090 |
| Vapour Pressure | 8.82E-06mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | UPUQOIKEAXWAON-UHFFFAOYSA-N |
| SMILES | O=C(ON=Cc1ccc(Cl)cc1)c1ccccc1 |
|
~%
[(4-chloropheny... CAS#:18802-67-0 |
| Literature: Hauser; Vermillion Journal of the American Chemical Society, 1941 , vol. 63, p. 1224,1226 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 4-Chlor-benzaldehyd-N-benzyl-oxim |