epi-(-)-Strigolactone GR24
Modify Date: 2026-07-17 22:32:18
epi-(-)-Strigolactone GR24 structure
|
Common Name | epi-(-)-Strigolactone GR24 | ||
|---|---|---|---|---|
| CAS Number | 188062-51-3 | Molecular Weight | 298.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | epi-(-)-Strigolactone GR24 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H14O5 |
|---|---|
| Molecular Weight | 298.29 |
| InChIKey | XHSDUVBUZOUAOQ-VEEPAONSSA-N |
| SMILES | CC1=CC(OC=C2C(=O)OC3c4ccccc4CC23)OC1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of epi-(-)-Strigolactone GR24? |
| A: Molecular weight of epi-(-)-Strigolactone GR24 is 298.29. |
| Q: What is the CAS number of epi-(-)-Strigolactone GR24? |
| A: CAS number of epi-(-)-Strigolactone GR24 is 188062-51-3. |
| Q: What is the English name of epi-(-)-Strigolactone GR24? |
| A: The English name of epi-(-)-Strigolactone GR24 is epi-(-)-Strigolactone GR24. |
| Q: What is the molecular formula of epi-(-)-Strigolactone GR24? |
| A: Molecular formula of epi-(-)-Strigolactone GR24 is C17H14O5. |
| Q: What is the SMILES notation of epi-(-)-Strigolactone GR24? |
| A: SMILES notation of epi-(-)-Strigolactone GR24 is CC1=CC(OC=C2C(=O)OC3c4ccccc4CC23)OC1=O. |
| Q: What is the Chinese name of 188062-51-3? |
| A: Chinese name of 188062-51-3 is 188062-51-3. |
| Q: What is the InChIKey of epi-(-)-Strigolactone GR24? |
| A: InChIKey of epi-(-)-Strigolactone GR24 is XHSDUVBUZOUAOQ-VEEPAONSSA-N. |