N,N-dimethyl-4,6-diphenyl-1,3,5-triazin-2-amine structure
|
Common Name | N,N-dimethyl-4,6-diphenyl-1,3,5-triazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 18808-10-1 | Molecular Weight | 276.33600 | |
| Density | 1.162g/cm3 | Boiling Point | 478.2ºC at 760mmHg | |
| Molecular Formula | C17H16N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243ºC | |
| Name | N,N-dimethyl-4,6-diphenyl-1,3,5-triazin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.162g/cm3 |
|---|---|
| Boiling Point | 478.2ºC at 760mmHg |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.33600 |
| Flash Point | 243ºC |
| Exact Mass | 276.13700 |
| PSA | 41.91000 |
| LogP | 3.27160 |
| Vapour Pressure | 2.62E-09mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | HVSPUVJKJLOMSX-UHFFFAOYSA-N |
| SMILES | CN(C)c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
|
~%
N,N-dimethyl-4,... CAS#:18808-10-1 |
| Literature: Boyd, Gerhard V.; Lindley, Peter F.; Nicolaou, George A. Journal of the Chemical Society, Chemical Communications, 1984 , # 16 p. 1105 - 1107 |
| 2,4-Diphenyl-6-dimethylamino-1,3,5-triazin |
| 2-DIMETHYLAMINO-4,6-DIPHENYL-S-TRIAZINE |