4-(2,4-Dichlorophenyl)-5-methyl-1,3-thiazol-2-amine structure
|
Common Name | 4-(2,4-Dichlorophenyl)-5-methyl-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 188120-61-8 | Molecular Weight | 259.15500 | |
| Density | 1.44g/cm3 | Boiling Point | 385.4ºC at 760 mmHg | |
| Molecular Formula | C10H8Cl2N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.9ºC | |
| Name | 4-(2,4-Dichlorophenyl)-5-methyl-1,3-thiazol-2-amine |
|---|
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 385.4ºC at 760 mmHg |
| Molecular Formula | C10H8Cl2N2S |
| Molecular Weight | 259.15500 |
| Flash Point | 186.9ºC |
| Exact Mass | 257.97900 |
| PSA | 67.15000 |
| LogP | 4.58870 |
| Vapour Pressure | 3.8E-06mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | SUELLSJOIIXFPP-UHFFFAOYSA-N |
| SMILES | Cc1sc(N)nc1-c1ccc(Cl)cc1Cl |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |