rel-1-((1R,8S,9s)-Bicyclo[6.1.0]non-4-yn-9-yl)-3-oxo-2,7,10,13,16-pentaoxa-4-azanonadecan-19-oic acid structure
|
Common Name | rel-1-((1R,8S,9s)-Bicyclo[6.1.0]non-4-yn-9-yl)-3-oxo-2,7,10,13,16-pentaoxa-4-azanonadecan-19-oic acid | ||
|---|---|---|---|---|
| CAS Number | 1881221-47-1 | Molecular Weight | 441.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H35NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of rel-1-((1R,8S,9s)-Bicyclo[6.1.0]non-4-yn-9-yl)-3-oxo-2,7,10,13,16-pentaoxa-4-azanonadecan-19-oic acidBCN-PEG4-acid is a cleavable 4 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | BCN-PEG4-acid |
|---|
| Description | BCN-PEG4-acid is a cleavable 4 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C22H35NO8 |
|---|---|
| Molecular Weight | 441.52 |
| InChIKey | MOPSTLKSTPBGBX-YOFSQIOKSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCNC(=O)OCC1C2CCC#CCCC21 |