N-(5-Bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroacetamide
Modify Date: 2025-09-10 09:56:30
N-(5-Bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroacetamide structure
|
Common Name | N-(5-Bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroacetamide | ||
|---|---|---|---|---|
| CAS Number | 1881331-06-1 | Molecular Weight | 320.46 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H3BrClF4NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(5-Bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroacetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H3BrClF4NO |
|---|---|
| Molecular Weight | 320.46 |
| InChIKey | BWAGRHISCARBNZ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cc(Br)cc(Cl)c1F)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N-(5-Bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroacetamide? |
| A: InChIKey of N-(5-Bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroacetamide is BWAGRHISCARBNZ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of N-(5-Bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroacetamide? |
| A: Molecular weight of N-(5-Bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroacetamide is 320.46. |
| Q: What is the SMILES notation of N-(5-Bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroacetamide? |
| A: SMILES notation of N-(5-Bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroacetamide is O=C(Nc1cc(Br)cc(Cl)c1F)C(F)(F)F. |
| Q: What is the Chinese name of 1881331-06-1? |
| A: Chinese name of 1881331-06-1 is 1881331-06-1. |
| Q: What is the CAS number of N-(5-Bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroacetamide? |
| A: CAS number of N-(5-Bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroacetamide is 1881331-06-1. |
| Q: What is the English name of N-(5-Bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroacetamide? |
| A: The English name of N-(5-Bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroacetamide is N-(5-Bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroacetamide. |
| Q: What is the molecular formula of N-(5-Bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroacetamide? |
| A: Molecular formula of N-(5-Bromo-3-chloro-2-fluorophenyl)-2,2,2-trifluoroacetamide is C8H3BrClF4NO. |