Methyl 3-bromo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate
Modify Date: 2026-09-20 20:48:32
![Methyl 3-bromo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate Structure](https://www.chemsrc.com/extcaspic/205/188240-62-2.png)
Methyl 3-bromo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate structure
|
Common Name | Methyl 3-bromo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 188240-62-2 | Molecular Weight | 275.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11BrO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 3-bromo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11BrO2S |
|---|---|
| Molecular Weight | 275.16 |
| InChIKey | VJSQBXFSPOTHED-UHFFFAOYSA-N |
| SMILES | COC(=O)c1sc(Br)c2c1CCCC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Methyl 3-bromo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate? |
| A: The English name of Methyl 3-bromo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate is Methyl 3-bromo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate. |
| Q: What is the InChIKey of Methyl 3-bromo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate? |
| A: InChIKey of Methyl 3-bromo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate is VJSQBXFSPOTHED-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 188240-62-2? |
| A: Chinese name of 188240-62-2 is 188240-62-2. |
| Q: What is the molecular weight of Methyl 3-bromo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate? |
| A: Molecular weight of Methyl 3-bromo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate is 275.16. |
| Q: What is the SMILES notation of Methyl 3-bromo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate? |
| A: SMILES notation of Methyl 3-bromo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate is COC(=O)c1sc(Br)c2c1CCCC2. |
| Q: What is the molecular formula of Methyl 3-bromo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate? |
| A: Molecular formula of Methyl 3-bromo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate is C10H11BrO2S. |
| Q: What is the CAS number of Methyl 3-bromo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate? |
| A: CAS number of Methyl 3-bromo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate is 188240-62-2. |