5,6,7,8,9,10-Hexahydro-11H-cyclohepta[b]quinoline-11-thione structure
|
Common Name | 5,6,7,8,9,10-Hexahydro-11H-cyclohepta[b]quinoline-11-thione | ||
|---|---|---|---|---|
| CAS Number | 18833-49-3 | Molecular Weight | 229.34100 | |
| Density | 1.21g/cm3 | Boiling Point | 367ºC at 760 mmHg | |
| Molecular Formula | C14H15NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.8ºC | |
| Name | 5,6,7,8,9,10-hexahydrocyclohepta[b]quinoline-11-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 367ºC at 760 mmHg |
| Molecular Formula | C14H15NS |
| Molecular Weight | 229.34100 |
| Flash Point | 175.8ºC |
| Exact Mass | 229.09300 |
| PSA | 47.88000 |
| LogP | 4.16630 |
| Vapour Pressure | 1.4E-05mmHg at 25°C |
| Index of Refraction | 1.659 |
| InChIKey | YBOMISGYHLRBLJ-UHFFFAOYSA-N |
| SMILES | S=c1c2c([nH]c3ccccc13)CCCCC2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,6,7,8,9,10-hexahydro-11H-cyclohepta<b>quinoleine-11-thione |