1-(Tert-butyl) 3-methyl 2-methyl-2-(5-nitropyridin-2-yl)malonate
Modify Date: 2025-09-09 21:43:53
1-(Tert-butyl) 3-methyl 2-methyl-2-(5-nitropyridin-2-yl)malonate structure
|
Common Name | 1-(Tert-butyl) 3-methyl 2-methyl-2-(5-nitropyridin-2-yl)malonate | ||
|---|---|---|---|---|
| CAS Number | 1883301-70-9 | Molecular Weight | 310.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(Tert-butyl) 3-methyl 2-methyl-2-(5-nitropyridin-2-yl)malonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H18N2O6 |
|---|---|
| Molecular Weight | 310.30 |
| InChIKey | LJVFJXUKTXNQMW-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)(C(=O)OC(C)(C)C)c1ccc([N+](=O)[O-])cn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-(Tert-butyl) 3-methyl 2-methyl-2-(5-nitropyridin-2-yl)malonate? |
| A: The English name of 1-(Tert-butyl) 3-methyl 2-methyl-2-(5-nitropyridin-2-yl)malonate is 1-(Tert-butyl) 3-methyl 2-methyl-2-(5-nitropyridin-2-yl)malonate. |
| Q: What is the SMILES notation of 1-(Tert-butyl) 3-methyl 2-methyl-2-(5-nitropyridin-2-yl)malonate? |
| A: SMILES notation of 1-(Tert-butyl) 3-methyl 2-methyl-2-(5-nitropyridin-2-yl)malonate is COC(=O)C(C)(C(=O)OC(C)(C)C)c1ccc([N+](=O)[O-])cn1. |
| Q: What is the Chinese name of 1883301-70-9? |
| A: Chinese name of 1883301-70-9 is 1883301-70-9. |
| Q: What is the CAS number of 1-(Tert-butyl) 3-methyl 2-methyl-2-(5-nitropyridin-2-yl)malonate? |
| A: CAS number of 1-(Tert-butyl) 3-methyl 2-methyl-2-(5-nitropyridin-2-yl)malonate is 1883301-70-9. |
| Q: What is the molecular weight of 1-(Tert-butyl) 3-methyl 2-methyl-2-(5-nitropyridin-2-yl)malonate? |
| A: Molecular weight of 1-(Tert-butyl) 3-methyl 2-methyl-2-(5-nitropyridin-2-yl)malonate is 310.30. |
| Q: What is the molecular formula of 1-(Tert-butyl) 3-methyl 2-methyl-2-(5-nitropyridin-2-yl)malonate? |
| A: Molecular formula of 1-(Tert-butyl) 3-methyl 2-methyl-2-(5-nitropyridin-2-yl)malonate is C14H18N2O6. |
| Q: What is the InChIKey of 1-(Tert-butyl) 3-methyl 2-methyl-2-(5-nitropyridin-2-yl)malonate? |
| A: InChIKey of 1-(Tert-butyl) 3-methyl 2-methyl-2-(5-nitropyridin-2-yl)malonate is LJVFJXUKTXNQMW-UHFFFAOYSA-N. |