2-(4-bromo-2,5-difluorophenoxy)-N,N-dimethylethan-1-amine
Modify Date: 2026-09-27 00:31:07
2-(4-bromo-2,5-difluorophenoxy)-N,N-dimethylethan-1-amine structure
|
Common Name | 2-(4-bromo-2,5-difluorophenoxy)-N,N-dimethylethan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 1883752-82-6 | Molecular Weight | 280.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12BrF2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-bromo-2,5-difluorophenoxy)-N,N-dimethylethan-1-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12BrF2NO |
|---|---|
| Molecular Weight | 280.11 |
| InChIKey | PJHCWYKXZORUTO-UHFFFAOYSA-N |
| SMILES | CN(C)CCOc1cc(F)c(Br)cc1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-(4-bromo-2,5-difluorophenoxy)-N,N-dimethylethan-1-amine? |
| A: InChIKey of 2-(4-bromo-2,5-difluorophenoxy)-N,N-dimethylethan-1-amine is PJHCWYKXZORUTO-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-(4-bromo-2,5-difluorophenoxy)-N,N-dimethylethan-1-amine? |
| A: CAS number of 2-(4-bromo-2,5-difluorophenoxy)-N,N-dimethylethan-1-amine is 1883752-82-6. |
| Q: What is the Chinese name of 1883752-82-6? |
| A: Chinese name of 1883752-82-6 is 1883752-82-6. |
| Q: What is the molecular weight of 2-(4-bromo-2,5-difluorophenoxy)-N,N-dimethylethan-1-amine? |
| A: Molecular weight of 2-(4-bromo-2,5-difluorophenoxy)-N,N-dimethylethan-1-amine is 280.11. |
| Q: What is the English name of 2-(4-bromo-2,5-difluorophenoxy)-N,N-dimethylethan-1-amine? |
| A: The English name of 2-(4-bromo-2,5-difluorophenoxy)-N,N-dimethylethan-1-amine is 2-(4-bromo-2,5-difluorophenoxy)-N,N-dimethylethan-1-amine. |
| Q: What is the molecular formula of 2-(4-bromo-2,5-difluorophenoxy)-N,N-dimethylethan-1-amine? |
| A: Molecular formula of 2-(4-bromo-2,5-difluorophenoxy)-N,N-dimethylethan-1-amine is C10H12BrF2NO. |
| Q: What is the SMILES notation of 2-(4-bromo-2,5-difluorophenoxy)-N,N-dimethylethan-1-amine? |
| A: SMILES notation of 2-(4-bromo-2,5-difluorophenoxy)-N,N-dimethylethan-1-amine is CN(C)CCOc1cc(F)c(Br)cc1F. |