(3R,4R)-6-(4-Chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octan-4-ol
Modify Date: 2026-08-16 15:41:56
![(3R,4R)-6-(4-Chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octan-4-ol Structure](https://www.chemsrc.com/extcaspic/369/1883756-73-7.png)
(3R,4R)-6-(4-Chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octan-4-ol structure
|
Common Name | (3R,4R)-6-(4-Chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octan-4-ol | ||
|---|---|---|---|---|
| CAS Number | 1883756-73-7 | Molecular Weight | 275.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12ClF2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3R,4R)-6-(4-Chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octan-4-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12ClF2NO2 |
|---|---|
| Molecular Weight | 275.68 |
| InChIKey | WVWOUPOXHSFHGA-ZYHUDNBSSA-N |
| SMILES | OC1CN(c2c(F)cc(Cl)cc2F)CCC12CO2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (3R,4R)-6-(4-Chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octan-4-ol? |
| A: Molecular formula of (3R,4R)-6-(4-Chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octan-4-ol is C12H12ClF2NO2. |
| Q: What is the SMILES notation of (3R,4R)-6-(4-Chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octan-4-ol? |
| A: SMILES notation of (3R,4R)-6-(4-Chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octan-4-ol is OC1CN(c2c(F)cc(Cl)cc2F)CCC12CO2. |
| Q: What is the molecular weight of (3R,4R)-6-(4-Chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octan-4-ol? |
| A: Molecular weight of (3R,4R)-6-(4-Chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octan-4-ol is 275.68. |
| Q: What is the CAS number of (3R,4R)-6-(4-Chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octan-4-ol? |
| A: CAS number of (3R,4R)-6-(4-Chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octan-4-ol is 1883756-73-7. |
| Q: What is the English name of (3R,4R)-6-(4-Chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octan-4-ol? |
| A: The English name of (3R,4R)-6-(4-Chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octan-4-ol is (3R,4R)-6-(4-Chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octan-4-ol. |
| Q: What is the InChIKey of (3R,4R)-6-(4-Chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octan-4-ol? |
| A: InChIKey of (3R,4R)-6-(4-Chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octan-4-ol is WVWOUPOXHSFHGA-ZYHUDNBSSA-N. |
| Q: What is the Chinese name of 1883756-73-7? |
| A: Chinese name of 1883756-73-7 is 1883756-73-7. |