(1R, 3S, 4R)-ent-Entecavir structure
|
Common Name | (1R, 3S, 4R)-ent-Entecavir | ||
|---|---|---|---|---|
| CAS Number | 188399-46-4 | Molecular Weight | 277.279 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H15N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (1R, 3S, 4R)-ent-Entecavir(1R,3S,4R)-ent-Entecavir ((1R,3S,4R)-ent-BMS200475; (1R,3S,4R)-ent-SQ34676) can be used to synthesize PROTAC targets to degrade deoxyribonucleic acid (DNA) polymerase[1]. |
| Name | 2-amino-9-[(1R,3S,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-3H-purin-6-one |
|---|---|
| Synonym | More Synonyms |
| Description | (1R,3S,4R)-ent-Entecavir ((1R,3S,4R)-ent-BMS200475; (1R,3S,4R)-ent-SQ34676) can be used to synthesize PROTAC targets to degrade deoxyribonucleic acid (DNA) polymerase[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.279 |
| Exact Mass | 277.117493 |
| PSA | 130.05000 |
| LogP | -0.96 |
| Index of Refraction | 1.837 |
| InChIKey | QDGZDCVAUDNJFG-BWZBUEFSSA-N |
| SMILES | C=C1C(CO)C(O)CC1n1cnc2c(=O)[nH]c(N)nc21 |
| 2-amino-9-[(1R,3S,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-9H-purin-6-ol |
| SC1449 |
| 6H-Purin-6-one, 2-amino-1,9-dihydro-9-[(1R,3S,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylenecyclopentyl]- |
| 2-Amino-1,9-dihydro-9-[(1R,3S,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylenecyclopentyl]-6H-Purin-6-one |
| 2-Amino-9-((1R,3S,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylenecyclopentyl)-1H-purin-6(9H)-one |
| 2-Amino-9-[(1R,3S,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylenecyclopentyl]-1,9-dihydro-6H-purin-6-one |
| Entecavir Impurity 3 |