US10336775, Example 41
Modify Date: 2025-09-09 20:25:07
US10336775, Example 41 structure
|
Common Name | US10336775, Example 41 | ||
|---|---|---|---|---|
| CAS Number | 1884153-74-5 | Molecular Weight | 333.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | US10336775, Example 41 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H19N5O2S |
|---|---|
| Molecular Weight | 333.4 |
| InChIKey | DHGBIJDAUNOPOX-UHFFFAOYSA-N |
| SMILES | CC(c1ccc2c(c1)OCO2)N1CCN(c2nnc(N)s2)CC1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Human O-GlcNAcase enzyme inhibition assay from US Patent US10336775: "Glycosidase inh...
Source: BindingDB
Target: N/A
External Id: BindingDB_8611_1
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of US10336775, Example 41? |
| A: SMILES notation of US10336775, Example 41 is CC(c1ccc2c(c1)OCO2)N1CCN(c2nnc(N)s2)CC1. |
| Q: What is the molecular weight of US10336775, Example 41? |
| A: Molecular weight of US10336775, Example 41 is 333.4. |
| Q: What is the InChIKey of US10336775, Example 41? |
| A: InChIKey of US10336775, Example 41 is DHGBIJDAUNOPOX-UHFFFAOYSA-N. |
| Q: What is the CAS number of US10336775, Example 41? |
| A: CAS number of US10336775, Example 41 is 1884153-74-5. |
| Q: What is the molecular formula of US10336775, Example 41? |
| A: Molecular formula of US10336775, Example 41 is C15H19N5O2S. |
| Q: What is the English name of US10336775, Example 41? |
| A: The English name of US10336775, Example 41 is US10336775, Example 41. |
| Q: What is the Chinese name of 1884153-74-5? |
| A: Chinese name of 1884153-74-5 is 1884153-74-5. |